C25H33N3O — CID 11661120
1-benzyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 11661120) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-benzyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-benzyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 11661120 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 1-benzyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CC12CCC(C1)C(C)(C)C2NC(=O)c1nn(Cc2ccccc2)c2c1CCCC2 |
| InChI | InChI=1S/C25H33N3O/c1-24(2)18-13-14-25(3,15-18)23(24)26-22(29)21-19-11-7-8-12-20(19)28(27-21)16-17-9-5-4-6-10-17/h4-6,9-10,18,23H,7-8,11-16H2,1-3H3,(H,26,29) |
| InChIKey | SRGXAYKGAWODED-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |