C16H26ClN3O — CID 116611307
1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-methyl-3-piperidin-3-ylbutan-2-one (PubChem CID 116611307) has the molecular formula C16H26ClN3O and a molecular weight of 311.86 g/mol. Its IUPAC name is 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-methyl-3-piperidin-3-ylbutan-2-one.
| Compound Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-methyl-3-piperidin-3-ylbutan-2-one |
|---|---|
| PubChem CID | 116611307 |
| Molecular Formula | C16H26ClN3O |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-methyl-3-piperidin-3-ylbutan-2-one |
| SMILES | CCc1nn(C)c(CC(=O)C(C)(C)C2CCCNC2)c1Cl |
| InChI | InChI=1S/C16H26ClN3O/c1-5-12-15(17)13(20(4)19-12)9-14(21)16(2,3)11-7-6-8-18-10-11/h11,18H,5-10H2,1-4H3 |
| InChIKey | MSENUIMUGYSBTA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |