About (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid
(Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 11661418) has the molecular formula C22H18N2O6
and a molecular weight of 406.39 g/mol. Its IUPAC name is (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid.
Molecular Properties
| Compound Name | (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid |
| PubChem CID | 11661418 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | O=C(O)C(=O)/C=C(\O)c1cn(Cc2ccccc2)c(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C22H18N2O6/c25-18(11-19(26)21(28)29)17-14-23(12-15-7-3-1-4-8-15)22(30)24(20(17)27)13-16-9-5-2-6-10-16/h1-11,14,25H,12-13H2,(H,28,29)/b18-11- |
| InChIKey | ZRGQCEQPAHCYJU-WQRHYEAKSA-N |
| XLogP | 1.66 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid?
The IUPAC name of (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid (CID 11661418) is (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid.
What is the SMILES notation for (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid?
The canonical SMILES for (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid is O=C(O)C(=O)/C=C(\O)c1cn(Cc2ccccc2)c(=O)n(Cc2ccccc2)c1=O.
What is the InChIKey of (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid?
The InChIKey is ZRGQCEQPAHCYJU-WQRHYEAKSA-N. The full InChI is InChI=1S/C22H18N2O6/c25-18(11-19(26)21(28)29)17-14-23(12-15-7-3-1-4-8-15)22(30)24(20(17)27)13-16-9-5-2-6-10-16/h1-11,14,25H,12-13H2,(H,28,29)/b18-11-.
What are the key properties of (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid?
(Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid has a molecular weight of 406.39 g/mol, XLogP of 1.66, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(1,3-dibenzyl-2,4-dioxopyrimidin-5-yl)-4-hydroxy-2-oxobut-3-enoic acid is sourced from PubChem (CID 11661418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).