C19H19F6NO2 — CID 11661439
2-[4-[ethyl-(2-hydroxy-2-phenylethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11661439) has the molecular formula C19H19F6NO2 and a molecular weight of 407.35 g/mol. Its IUPAC name is 2-[4-[ethyl-(2-hydroxy-2-phenylethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[ethyl-(2-hydroxy-2-phenylethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11661439 |
| Molecular Formula | C19H19F6NO2 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-[4-[ethyl-(2-hydroxy-2-phenylethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCN(CC(O)c1ccccc1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F6NO2/c1-2-26(12-16(27)13-6-4-3-5-7-13)15-10-8-14(9-11-15)17(28,18(20,21)22)19(23,24)25/h3-11,16,27-28H,2,12H2,1H3 |
| InChIKey | AQQQQVJBCMSSHB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|