C25H28O5 — CID 11661464
[(1R,5R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] benzoate (PubChem CID 11661464) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is [(1R,5R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] benzoate.
| Compound Name | [(1R,5R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] benzoate |
|---|---|
| PubChem CID | 11661464 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [(1R,5R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] benzoate |
| SMILES | CC(C)=CCC/C(C)=C/[C@H]1OC(=O)C[C@]12C[C@H](OC(=O)c1ccccc1)C=CC2=O |
| InChI | InChI=1S/C25H28O5/c1-17(2)8-7-9-18(3)14-22-25(16-23(27)30-22)15-20(12-13-21(25)26)29-24(28)19-10-5-4-6-11-19/h4-6,8,10-14,20,22H,7,9,15-16H2,1-3H3/b18-14+/t20-,22-,25+/m1/s1 |
| InChIKey | DSAVHUDOHSNVEB-SIBILXBISA-N |
| XLogP | 4.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|