C13H16F3NOS — CID 116615123
5-[2-(trifluoromethylsulfanyl)ethoxy]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 116615123) has the molecular formula C13H16F3NOS and a molecular weight of 291.34 g/mol. Its IUPAC name is 5-[2-(trifluoromethylsulfanyl)ethoxy]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 5-[2-(trifluoromethylsulfanyl)ethoxy]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 116615123 |
| Molecular Formula | C13H16F3NOS |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 5-[2-(trifluoromethylsulfanyl)ethoxy]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | NC1CCCc2c(OCCSC(F)(F)F)cccc21 |
| InChI | InChI=1S/C13H16F3NOS/c14-13(15,16)19-8-7-18-12-6-2-3-9-10(12)4-1-5-11(9)17/h2-3,6,11H,1,4-5,7-8,17H2 |
| InChIKey | GHJCJDWRUWERAD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|