C10H21F3N2S — CID 116615464
1-N,1-N,3-trimethyl-2-N-[2-(trifluoromethylsulfanyl)ethyl]butane-1,2-diamine (PubChem CID 116615464) has the molecular formula C10H21F3N2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 1-N,1-N,3-trimethyl-2-N-[2-(trifluoromethylsulfanyl)ethyl]butane-1,2-diamine.
| Compound Name | 1-N,1-N,3-trimethyl-2-N-[2-(trifluoromethylsulfanyl)ethyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 116615464 |
| Molecular Formula | C10H21F3N2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-N,1-N,3-trimethyl-2-N-[2-(trifluoromethylsulfanyl)ethyl]butane-1,2-diamine |
| SMILES | CC(C)C(CN(C)C)NCCSC(F)(F)F |
| InChI | InChI=1S/C10H21F3N2S/c1-8(2)9(7-15(3)4)14-5-6-16-10(11,12)13/h8-9,14H,5-7H2,1-4H3 |
| InChIKey | PWDUJRINWFSBBL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|