C9H6Cl2F3N3S2 — CID 116615616
3,5-dichloro-N-[2-(trifluoromethylsulfanyl)ethyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 116615616) has the molecular formula C9H6Cl2F3N3S2 and a molecular weight of 348.20 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(trifluoromethylsulfanyl)ethyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | 3,5-dichloro-N-[2-(trifluoromethylsulfanyl)ethyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 116615616 |
| Molecular Formula | C9H6Cl2F3N3S2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 346.93 |
| IUPAC Name | 3,5-dichloro-N-[2-(trifluoromethylsulfanyl)ethyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | FC(F)(F)SCCNc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C9H6Cl2F3N3S2/c10-4-3-5(11)7-8(17-19-16-7)6(4)15-1-2-18-9(12,13)14/h3,15H,1-2H2 |
| InChIKey | IHWGFJJXNRQXEX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|