C10H20F3NOS — CID 116615640
2,4-dimethyl-1-[2-(trifluoromethylsulfanyl)ethylamino]pentan-2-ol (PubChem CID 116615640) has the molecular formula C10H20F3NOS and a molecular weight of 259.34 g/mol. Its IUPAC name is 2,4-dimethyl-1-[2-(trifluoromethylsulfanyl)ethylamino]pentan-2-ol.
| Compound Name | 2,4-dimethyl-1-[2-(trifluoromethylsulfanyl)ethylamino]pentan-2-ol |
|---|---|
| PubChem CID | 116615640 |
| Molecular Formula | C10H20F3NOS |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2,4-dimethyl-1-[2-(trifluoromethylsulfanyl)ethylamino]pentan-2-ol |
| SMILES | CC(C)CC(C)(O)CNCCSC(F)(F)F |
| InChI | InChI=1S/C10H20F3NOS/c1-8(2)6-9(3,15)7-14-4-5-16-10(11,12)13/h8,14-15H,4-7H2,1-3H3 |
| InChIKey | OKYDDRWDUSQAEZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|