C23H34F3NO2 — CID 11661576
(2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluoro-3-methylbutan-2-ol (PubChem CID 11661576) has the molecular formula C23H34F3NO2 and a molecular weight of 413.52 g/mol. Its IUPAC name is (2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluoro-3-methylbutan-2-ol.
| Compound Name | (2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluoro-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 11661576 |
| Molecular Formula | C23H34F3NO2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | (2S)-2-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-1,1,1-trifluoro-3-methylbutan-2-ol |
| SMILES | CC(C)[C@](O)([C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H34F3NO2/c1-15(2)22(28,23(24,25)26)20-27(14-17-9-7-6-8-10-17)21(4,5)18-12-11-16(3)13-19(18)29-20/h6-10,15-16,18-20,28H,11-14H2,1-5H3/t16-,18-,19-,20+,22+/m1/s1 |
| InChIKey | HXDWCGHZYYCMTQ-VSVJCKIPSA-N |
| XLogP | 5.38 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |