About N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine
N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine (PubChem CID 116616259) has the molecular formula C10H21F3N2S
and a molecular weight of 258.35 g/mol. Its IUPAC name is N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine |
| PubChem CID | 116616259 |
| Molecular Formula | C10H21F3N2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine |
| SMILES | CN(CCNC(C)(C)C)CCSC(F)(F)F |
| InChI | InChI=1S/C10H21F3N2S/c1-9(2,3)14-5-6-15(4)7-8-16-10(11,12)13/h14H,5-8H2,1-4H3 |
| InChIKey | CZXSPQMBPJQSSQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine?
The IUPAC name of N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine (CID 116616259) is N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine.
What is the SMILES notation for N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine?
The canonical SMILES for N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine is CN(CCNC(C)(C)C)CCSC(F)(F)F.
What is the InChIKey of N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine?
The InChIKey is CZXSPQMBPJQSSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F3N2S/c1-9(2,3)14-5-6-15(4)7-8-16-10(11,12)13/h14H,5-8H2,1-4H3.
What are the key properties of N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine?
N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine has a molecular weight of 258.35 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-methyl-N'-[2-(trifluoromethylsulfanyl)ethyl]ethane-1,2-diamine is sourced from PubChem (CID 116616259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).