C11H22F3NS — CID 116616639
N-ethyl-2,2-dimethyl-6-(trifluoromethylsulfanyl)hexan-3-amine (PubChem CID 116616639) has the molecular formula C11H22F3NS and a molecular weight of 257.36 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-6-(trifluoromethylsulfanyl)hexan-3-amine.
| Compound Name | N-ethyl-2,2-dimethyl-6-(trifluoromethylsulfanyl)hexan-3-amine |
|---|---|
| PubChem CID | 116616639 |
| Molecular Formula | C11H22F3NS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-ethyl-2,2-dimethyl-6-(trifluoromethylsulfanyl)hexan-3-amine |
| SMILES | CCNC(CCCSC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C11H22F3NS/c1-5-15-9(10(2,3)4)7-6-8-16-11(12,13)14/h9,15H,5-8H2,1-4H3 |
| InChIKey | AHKZJEVNKCZPGD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|