C14H26F3NS — CID 116616694
N-ethyl-4-propan-2-yl-2-[2-(trifluoromethylsulfanyl)ethyl]cyclohexan-1-amine (PubChem CID 116616694) has the molecular formula C14H26F3NS and a molecular weight of 297.43 g/mol. Its IUPAC name is N-ethyl-4-propan-2-yl-2-[2-(trifluoromethylsulfanyl)ethyl]cyclohexan-1-amine.
| Compound Name | N-ethyl-4-propan-2-yl-2-[2-(trifluoromethylsulfanyl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 116616694 |
| Molecular Formula | C14H26F3NS |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-ethyl-4-propan-2-yl-2-[2-(trifluoromethylsulfanyl)ethyl]cyclohexan-1-amine |
| SMILES | CCNC1CCC(C(C)C)CC1CCSC(F)(F)F |
| InChI | InChI=1S/C14H26F3NS/c1-4-18-13-6-5-11(10(2)3)9-12(13)7-8-19-14(15,16)17/h10-13,18H,4-9H2,1-3H3 |
| InChIKey | OMCRLMZRNBEHDF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |