C14H18F3N3S — CID 116617067
N-[[1-[2-(trifluoromethylsulfanyl)ethyl]pyrrolo[2,3-b]pyridin-3-yl]methyl]propan-1-amine (PubChem CID 116617067) has the molecular formula C14H18F3N3S and a molecular weight of 317.38 g/mol. Its IUPAC name is N-[[1-[2-(trifluoromethylsulfanyl)ethyl]pyrrolo[2,3-b]pyridin-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[2-(trifluoromethylsulfanyl)ethyl]pyrrolo[2,3-b]pyridin-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 116617067 |
| Molecular Formula | C14H18F3N3S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[[1-[2-(trifluoromethylsulfanyl)ethyl]pyrrolo[2,3-b]pyridin-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(CCSC(F)(F)F)c2ncccc12 |
| InChI | InChI=1S/C14H18F3N3S/c1-2-5-18-9-11-10-20(7-8-21-14(15,16)17)13-12(11)4-3-6-19-13/h3-4,6,10,18H,2,5,7-9H2,1H3 |
| InChIKey | TZYNJDFBBKIKLC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|