C11H17F3N2OS — CID 116617531
1-[2-(trifluoromethylsulfanyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one (PubChem CID 116617531) has the molecular formula C11H17F3N2OS and a molecular weight of 282.33 g/mol. Its IUPAC name is 1-[2-(trifluoromethylsulfanyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one.
| Compound Name | 1-[2-(trifluoromethylsulfanyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 116617531 |
| Molecular Formula | C11H17F3N2OS |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-[2-(trifluoromethylsulfanyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one |
| SMILES | O=C1CCC2CNCCC2N1CCSC(F)(F)F |
| InChI | InChI=1S/C11H17F3N2OS/c12-11(13,14)18-6-5-16-9-3-4-15-7-8(9)1-2-10(16)17/h8-9,15H,1-7H2 |
| InChIKey | HJNQYWUECJWQSN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |