C16H30F3NS — CID 116617715
N-[[4-butyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methyl]ethanamine (PubChem CID 116617715) has the molecular formula C16H30F3NS and a molecular weight of 325.48 g/mol. Its IUPAC name is N-[[4-butyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methyl]ethanamine.
| Compound Name | N-[[4-butyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methyl]ethanamine |
|---|---|
| PubChem CID | 116617715 |
| Molecular Formula | C16H30F3NS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | N-[[4-butyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methyl]ethanamine |
| SMILES | CCCCC1CCC(CCSC(F)(F)F)(CNCC)CC1 |
| InChI | InChI=1S/C16H30F3NS/c1-3-5-6-14-7-9-15(10-8-14,13-20-4-2)11-12-21-16(17,18)19/h14,20H,3-13H2,1-2H3 |
| InChIKey | IWVHFNWHIYBLJH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |