C12H24F3NS — CID 116617736
2-ethyl-N-methyl-2-[2-(trifluoromethylsulfanyl)ethyl]hexan-1-amine (PubChem CID 116617736) has the molecular formula C12H24F3NS and a molecular weight of 271.39 g/mol. Its IUPAC name is 2-ethyl-N-methyl-2-[2-(trifluoromethylsulfanyl)ethyl]hexan-1-amine.
| Compound Name | 2-ethyl-N-methyl-2-[2-(trifluoromethylsulfanyl)ethyl]hexan-1-amine |
|---|---|
| PubChem CID | 116617736 |
| Molecular Formula | C12H24F3NS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-ethyl-N-methyl-2-[2-(trifluoromethylsulfanyl)ethyl]hexan-1-amine |
| SMILES | CCCCC(CC)(CCSC(F)(F)F)CNC |
| InChI | InChI=1S/C12H24F3NS/c1-4-6-7-11(5-2,10-16-3)8-9-17-12(13,14)15/h16H,4-10H2,1-3H3 |
| InChIKey | UHZSGNMPWIJANM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |