C15H22F3NS — CID 116617750
N,2-diethyl-2-phenyl-4-(trifluoromethylsulfanyl)butan-1-amine (PubChem CID 116617750) has the molecular formula C15H22F3NS and a molecular weight of 305.41 g/mol. Its IUPAC name is N,2-diethyl-2-phenyl-4-(trifluoromethylsulfanyl)butan-1-amine.
| Compound Name | N,2-diethyl-2-phenyl-4-(trifluoromethylsulfanyl)butan-1-amine |
|---|---|
| PubChem CID | 116617750 |
| Molecular Formula | C15H22F3NS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N,2-diethyl-2-phenyl-4-(trifluoromethylsulfanyl)butan-1-amine |
| SMILES | CCNCC(CC)(CCSC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H22F3NS/c1-3-14(12-19-4-2,10-11-20-15(16,17)18)13-8-6-5-7-9-13/h5-9,19H,3-4,10-12H2,1-2H3 |
| InChIKey | ZWUADFSSHOYJFX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |