C13H17BrF3NS — CID 116617873
2-(3-bromophenyl)-N-ethyl-4-(trifluoromethylsulfanyl)butan-1-amine (PubChem CID 116617873) has the molecular formula C13H17BrF3NS and a molecular weight of 356.25 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-ethyl-4-(trifluoromethylsulfanyl)butan-1-amine.
| Compound Name | 2-(3-bromophenyl)-N-ethyl-4-(trifluoromethylsulfanyl)butan-1-amine |
|---|---|
| PubChem CID | 116617873 |
| Molecular Formula | C13H17BrF3NS |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 2-(3-bromophenyl)-N-ethyl-4-(trifluoromethylsulfanyl)butan-1-amine |
| SMILES | CCNCC(CCSC(F)(F)F)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H17BrF3NS/c1-2-18-9-11(6-7-19-13(15,16)17)10-4-3-5-12(14)8-10/h3-5,8,11,18H,2,6-7,9H2,1H3 |
| InChIKey | JEIJNHJZGRVVLH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |