C16H22N2O — CID 116618934
N-butyl-2-(7-ethylindol-1-yl)acetamide (PubChem CID 116618934) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is N-butyl-2-(7-ethylindol-1-yl)acetamide.
| Compound Name | N-butyl-2-(7-ethylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 116618934 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-butyl-2-(7-ethylindol-1-yl)acetamide |
| SMILES | CCCCNC(=O)Cn1ccc2cccc(CC)c21 |
| InChI | InChI=1S/C16H22N2O/c1-3-5-10-17-15(19)12-18-11-9-14-8-6-7-13(4-2)16(14)18/h6-9,11H,3-5,10,12H2,1-2H3,(H,17,19) |
| InChIKey | YXBHGXBFLYOHOR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|