C25H40O4Si — CID 11661988
(1S,2S,5aS,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2-methoxy-8,9a-dimethyl-1-prop-1-en-2-yl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-9-one (PubChem CID 11661988) has the molecular formula C25H40O4Si and a molecular weight of 432.68 g/mol. Its IUPAC name is (1S,2S,5aS,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2-methoxy-8,9a-dimethyl-1-prop-1-en-2-yl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-9-one.
| Compound Name | (1S,2S,5aS,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2-methoxy-8,9a-dimethyl-1-prop-1-en-2-yl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-9-one |
|---|---|
| PubChem CID | 11661988 |
| Molecular Formula | C25H40O4Si |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (1S,2S,5aS,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2-methoxy-8,9a-dimethyl-1-prop-1-en-2-yl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-9-one |
| SMILES | C=C(C)[C@H]1[C@@H](OC)CC2=C(O[Si](C)(C)C(C)(C)C)C[C@@H]3C(O)C=C(C)C(=O)[C@]3(C)[C@@H]21 |
| InChI | InChI=1S/C25H40O4Si/c1-14(2)21-20(28-8)12-16-19(29-30(9,10)24(4,5)6)13-17-18(26)11-15(3)23(27)25(17,7)22(16)21/h11,17-18,20-22,26H,1,12-13H2,2-10H3/t17-,18?,20+,21+,22+,25+/m1/s1 |
| InChIKey | OJKZKDYEFRNFAW-MBROWAEPSA-N |
| XLogP | 5.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|