About 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole
1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole (PubChem CID 116619963) has the molecular formula C11H8Cl2FN
and a molecular weight of 244.10 g/mol. Its IUPAC name is 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole.
Molecular Properties
| Compound Name | 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole |
| PubChem CID | 116619963 |
| Molecular Formula | C11H8Cl2FN |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole |
| SMILES | Fc1ccc2ccn(C/C(Cl)=C/Cl)c2c1 |
| InChI | InChI=1S/C11H8Cl2FN/c12-6-9(13)7-15-4-3-8-1-2-10(14)5-11(8)15/h1-6H,7H2/b9-6- |
| InChIKey | VTHRIAIDDBGNAG-TWGQIWQCSA-N |
| XLogP | 4.10 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole?
The IUPAC name of 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole (CID 116619963) is 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole.
What is the SMILES notation for 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole?
The canonical SMILES for 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole is Fc1ccc2ccn(C/C(Cl)=C/Cl)c2c1.
What is the InChIKey of 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole?
The InChIKey is VTHRIAIDDBGNAG-TWGQIWQCSA-N. The full InChI is InChI=1S/C11H8Cl2FN/c12-6-9(13)7-15-4-3-8-1-2-10(14)5-11(8)15/h1-6H,7H2/b9-6-.
What are the key properties of 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole?
1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole has a molecular weight of 244.10 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-2,3-dichloroprop-2-enyl]-6-fluoroindole is sourced from PubChem (CID 116619963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).