C19H19NO — CID 116620301
1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-4-methylindole (PubChem CID 116620301) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-4-methylindole.
| Compound Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-4-methylindole |
|---|---|
| PubChem CID | 116620301 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-4-methylindole |
| SMILES | Cc1cccc2c1ccn2CCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C19H19NO/c1-14-3-2-4-18-17(14)8-11-20(18)10-7-15-5-6-19-16(13-15)9-12-21-19/h2-6,8,11,13H,7,9-10,12H2,1H3 |
| InChIKey | RDYYNRIXOHHCGP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |