C23H21F2N5O2 — CID 11662078
N-(2,4-difluorophenyl)-3-(2-methoxy-5-morpholin-4-ylphenyl)-2H-pyrazolo[3,4-b]pyridin-6-amine (PubChem CID 11662078) has the molecular formula C23H21F2N5O2 and a molecular weight of 437.45 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-(2-methoxy-5-morpholin-4-ylphenyl)-2H-pyrazolo[3,4-b]pyridin-6-amine.
| Compound Name | N-(2,4-difluorophenyl)-3-(2-methoxy-5-morpholin-4-ylphenyl)-2H-pyrazolo[3,4-b]pyridin-6-amine |
|---|---|
| PubChem CID | 11662078 |
| Molecular Formula | C23H21F2N5O2 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-(2-methoxy-5-morpholin-4-ylphenyl)-2H-pyrazolo[3,4-b]pyridin-6-amine |
| SMILES | COc1ccc(N2CCOCC2)cc1-c1[nH]nc2nc(Nc3ccc(F)cc3F)ccc12 |
| InChI | InChI=1S/C23H21F2N5O2/c1-31-20-6-3-15(30-8-10-32-11-9-30)13-17(20)22-16-4-7-21(27-23(16)29-28-22)26-19-5-2-14(24)12-18(19)25/h2-7,12-13H,8-11H2,1H3,(H2,26,27,28,29) |
| InChIKey | DCHUVUWVTFIMPZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|