C25H46O4Si — CID 11662117
[(3aR,5S,6R,8aR,9R,9aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2,6,8a-tetramethyl-9-propan-2-yl-3a,5,7,8,9,9a-hexahydroazuleno[1,2-d][1,3]dioxol-6-yl]methanol (PubChem CID 11662117) has the molecular formula C25H46O4Si and a molecular weight of 438.73 g/mol. Its IUPAC name is [(3aR,5S,6R,8aR,9R,9aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2,6,8a-tetramethyl-9-propan-2-yl-3a,5,7,8,9,9a-hexahydroazuleno[1,2-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aR,5S,6R,8aR,9R,9aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2,6,8a-tetramethyl-9-propan-2-yl-3a,5,7,8,9,9a-hexahydroazuleno[1,2-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 11662117 |
| Molecular Formula | C25H46O4Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | [(3aR,5S,6R,8aR,9R,9aS)-5-[tert-butyl(dimethyl)silyl]oxy-2,2,6,8a-tetramethyl-9-propan-2-yl-3a,5,7,8,9,9a-hexahydroazuleno[1,2-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC(C)[C@H]1[C@@H]2OC(C)(C)O[C@@H]2C2=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@](C)(CO)CC[C@@]21C |
| InChI | InChI=1S/C25H46O4Si/c1-16(2)19-21-20(27-23(6,7)28-21)17-14-18(29-30(10,11)22(3,4)5)24(8,15-26)12-13-25(17,19)9/h14,16,18-21,26H,12-13,15H2,1-11H3/t18-,19-,20+,21-,24+,25-/m0/s1 |
| InChIKey | XWCPJJZETJJCNX-SKKGOUAMSA-N |
| XLogP | 5.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|