C10H9F3N2S — CID 116621313
1-(2-thiophen-3-ylethyl)-3-(trifluoromethyl)pyrazole (PubChem CID 116621313) has the molecular formula C10H9F3N2S and a molecular weight of 246.26 g/mol. Its IUPAC name is 1-(2-thiophen-3-ylethyl)-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-(2-thiophen-3-ylethyl)-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 116621313 |
| Molecular Formula | C10H9F3N2S |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 1-(2-thiophen-3-ylethyl)-3-(trifluoromethyl)pyrazole |
| SMILES | FC(F)(F)c1ccn(CCc2ccsc2)n1 |
| InChI | InChI=1S/C10H9F3N2S/c11-10(12,13)9-2-5-15(14-9)4-1-8-3-6-16-7-8/h2-3,5-7H,1,4H2 |
| InChIKey | AKAFQCYPTRYMQT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |