C15H18N4S — CID 116621627
1,3-diethyl-5-[(2-thiophen-2-ylimidazol-1-yl)methyl]pyrazole (PubChem CID 116621627) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is 1,3-diethyl-5-[(2-thiophen-2-ylimidazol-1-yl)methyl]pyrazole.
| Compound Name | 1,3-diethyl-5-[(2-thiophen-2-ylimidazol-1-yl)methyl]pyrazole |
|---|---|
| PubChem CID | 116621627 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1,3-diethyl-5-[(2-thiophen-2-ylimidazol-1-yl)methyl]pyrazole |
| SMILES | CCc1cc(Cn2ccnc2-c2cccs2)n(CC)n1 |
| InChI | InChI=1S/C15H18N4S/c1-3-12-10-13(19(4-2)17-12)11-18-8-7-16-15(18)14-6-5-9-20-14/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | TXVQLJCVWSTIBX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |