About 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one
3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one (PubChem CID 116622801) has the molecular formula C10H13N5O
and a molecular weight of 219.25 g/mol. Its IUPAC name is 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one |
| PubChem CID | 116622801 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one |
| SMILES | CC(C)n1ncnc1Cn1cnccc1=O |
| InChI | InChI=1S/C10H13N5O/c1-8(2)15-9(12-6-13-15)5-14-7-11-4-3-10(14)16/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | NYAANJKHMBLIEM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one?
The IUPAC name of 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one (CID 116622801) is 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one.
What is the SMILES notation for 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one?
The canonical SMILES for 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one is CC(C)n1ncnc1Cn1cnccc1=O.
What is the InChIKey of 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one?
The InChIKey is NYAANJKHMBLIEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O/c1-8(2)15-9(12-6-13-15)5-14-7-11-4-3-10(14)16/h3-4,6-8H,5H2,1-2H3.
What are the key properties of 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one?
3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one has a molecular weight of 219.25 g/mol, XLogP of 0.46, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one is sourced from PubChem (CID 116622801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).