C13H13N3O — CID 116622953
3-methyl-4-[(5-methylindol-1-yl)methyl]-1,2,5-oxadiazole (PubChem CID 116622953) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 3-methyl-4-[(5-methylindol-1-yl)methyl]-1,2,5-oxadiazole.
| Compound Name | 3-methyl-4-[(5-methylindol-1-yl)methyl]-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 116622953 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-methyl-4-[(5-methylindol-1-yl)methyl]-1,2,5-oxadiazole |
| SMILES | Cc1ccc2c(ccn2Cc2nonc2C)c1 |
| InChI | InChI=1S/C13H13N3O/c1-9-3-4-13-11(7-9)5-6-16(13)8-12-10(2)14-17-15-12/h3-7H,8H2,1-2H3 |
| InChIKey | KHVIHNKADJVWHB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |