C13H13ClN4 — CID 116623294
5-chloro-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]indole (PubChem CID 116623294) has the molecular formula C13H13ClN4 and a molecular weight of 260.73 g/mol. Its IUPAC name is 5-chloro-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]indole.
| Compound Name | 5-chloro-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]indole |
|---|---|
| PubChem CID | 116623294 |
| Molecular Formula | C13H13ClN4 |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-chloro-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]indole |
| SMILES | Cc1nnc(Cn2ccc3cc(Cl)ccc32)n1C |
| InChI | InChI=1S/C13H13ClN4/c1-9-15-16-13(17(9)2)8-18-6-5-10-7-11(14)3-4-12(10)18/h3-7H,8H2,1-2H3 |
| InChIKey | LDXLMTFYDXWKQB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |