C25H27NO7 — CID 11662445
[(1R,2S,6R,7S,8R)-1-acetyloxy-5-oxo-6,7-bis(phenylmethoxy)-1,2,3,6,7,8-hexahydropyrrolizin-2-yl] acetate (PubChem CID 11662445) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is [(1R,2S,6R,7S,8R)-1-acetyloxy-5-oxo-6,7-bis(phenylmethoxy)-1,2,3,6,7,8-hexahydropyrrolizin-2-yl] acetate.
| Compound Name | [(1R,2S,6R,7S,8R)-1-acetyloxy-5-oxo-6,7-bis(phenylmethoxy)-1,2,3,6,7,8-hexahydropyrrolizin-2-yl] acetate |
|---|---|
| PubChem CID | 11662445 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [(1R,2S,6R,7S,8R)-1-acetyloxy-5-oxo-6,7-bis(phenylmethoxy)-1,2,3,6,7,8-hexahydropyrrolizin-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)C(=O)N2C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H27NO7/c1-16(27)32-20-13-26-21(22(20)33-17(2)28)23(30-14-18-9-5-3-6-10-18)24(25(26)29)31-15-19-11-7-4-8-12-19/h3-12,20-24H,13-15H2,1-2H3/t20-,21-,22-,23-,24+/m0/s1 |
| InChIKey | PAGVWWSQLMQJLT-QCCYXRBGSA-N |
| XLogP | 2.24 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |