C18H24N2O — CID 116625622
2,2-dimethyl-5-(5-propoxyindol-1-yl)pentanenitrile (PubChem CID 116625622) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2,2-dimethyl-5-(5-propoxyindol-1-yl)pentanenitrile.
| Compound Name | 2,2-dimethyl-5-(5-propoxyindol-1-yl)pentanenitrile |
|---|---|
| PubChem CID | 116625622 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2,2-dimethyl-5-(5-propoxyindol-1-yl)pentanenitrile |
| SMILES | CCCOc1ccc2c(ccn2CCCC(C)(C)C#N)c1 |
| InChI | InChI=1S/C18H24N2O/c1-4-12-21-16-6-7-17-15(13-16)8-11-20(17)10-5-9-18(2,3)14-19/h6-8,11,13H,4-5,9-10,12H2,1-3H3 |
| InChIKey | ATPNCKZVZVNKPW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |