C15H19BrN2O2S — CID 116626214
4-bromo-1-[(1-methylsulfonylpiperidin-3-yl)methyl]indole (PubChem CID 116626214) has the molecular formula C15H19BrN2O2S and a molecular weight of 371.30 g/mol. Its IUPAC name is 4-bromo-1-[(1-methylsulfonylpiperidin-3-yl)methyl]indole.
| Compound Name | 4-bromo-1-[(1-methylsulfonylpiperidin-3-yl)methyl]indole |
|---|---|
| PubChem CID | 116626214 |
| Molecular Formula | C15H19BrN2O2S |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 4-bromo-1-[(1-methylsulfonylpiperidin-3-yl)methyl]indole |
| SMILES | CS(=O)(=O)N1CCCC(Cn2ccc3c(Br)cccc32)C1 |
| InChI | InChI=1S/C15H19BrN2O2S/c1-21(19,20)18-8-3-4-12(11-18)10-17-9-7-13-14(16)5-2-6-15(13)17/h2,5-7,9,12H,3-4,8,10-11H2,1H3 |
| InChIKey | RISDKWFZJFFGRI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |