C16H17BrN2S — CID 116626215
2-[(4-bromoindol-1-yl)methyl]-4-tert-butyl-1,3-thiazole (PubChem CID 116626215) has the molecular formula C16H17BrN2S and a molecular weight of 349.30 g/mol. Its IUPAC name is 2-[(4-bromoindol-1-yl)methyl]-4-tert-butyl-1,3-thiazole.
| Compound Name | 2-[(4-bromoindol-1-yl)methyl]-4-tert-butyl-1,3-thiazole |
|---|---|
| PubChem CID | 116626215 |
| Molecular Formula | C16H17BrN2S |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-[(4-bromoindol-1-yl)methyl]-4-tert-butyl-1,3-thiazole |
| SMILES | CC(C)(C)c1csc(Cn2ccc3c(Br)cccc32)n1 |
| InChI | InChI=1S/C16H17BrN2S/c1-16(2,3)14-10-20-15(18-14)9-19-8-7-11-12(17)5-4-6-13(11)19/h4-8,10H,9H2,1-3H3 |
| InChIKey | ORCYVOSPKWTSSH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |