C12H18N2 — CID 116626340
1-pent-4-enyl-4,5,6,7-tetrahydrobenzimidazole (PubChem CID 116626340) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-pent-4-enyl-4,5,6,7-tetrahydrobenzimidazole.
| Compound Name | 1-pent-4-enyl-4,5,6,7-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 116626340 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-pent-4-enyl-4,5,6,7-tetrahydrobenzimidazole |
| SMILES | C=CCCCn1cnc2c1CCCC2 |
| InChI | InChI=1S/C12H18N2/c1-2-3-6-9-14-10-13-11-7-4-5-8-12(11)14/h2,10H,1,3-9H2 |
| InChIKey | UYBQETCOVKBEQP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|