C10H17N3O2 — CID 116626772
4-methyl-2-[3-(oxolan-2-yl)propyl]-1,2,4-triazol-3-one (PubChem CID 116626772) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-methyl-2-[3-(oxolan-2-yl)propyl]-1,2,4-triazol-3-one.
| Compound Name | 4-methyl-2-[3-(oxolan-2-yl)propyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 116626772 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 4-methyl-2-[3-(oxolan-2-yl)propyl]-1,2,4-triazol-3-one |
| SMILES | Cn1cnn(CCCC2CCCO2)c1=O |
| InChI | InChI=1S/C10H17N3O2/c1-12-8-11-13(10(12)14)6-2-4-9-5-3-7-15-9/h8-9H,2-7H2,1H3 |
| InChIKey | JOXDFDRLOLAQRH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |