C24H28N6O2S — CID 11662683
13-N-(2-methoxyethyl)-8-N,4,4-trimethyl-8-N-(pyridin-3-ylmethyl)-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene-8,13-diamine (PubChem CID 11662683) has the molecular formula C24H28N6O2S and a molecular weight of 464.60 g/mol. Its IUPAC name is 13-N-(2-methoxyethyl)-8-N,4,4-trimethyl-8-N-(pyridin-3-ylmethyl)-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene-8,13-diamine.
| Compound Name | 13-N-(2-methoxyethyl)-8-N,4,4-trimethyl-8-N-(pyridin-3-ylmethyl)-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene-8,13-diamine |
|---|---|
| PubChem CID | 11662683 |
| Molecular Formula | C24H28N6O2S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 13-N-(2-methoxyethyl)-8-N,4,4-trimethyl-8-N-(pyridin-3-ylmethyl)-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaene-8,13-diamine |
| SMILES | COCCNc1ncnc2c1sc1nc(N(C)Cc3cccnc3)c3c(c12)CC(C)(C)OC3 |
| InChI | InChI=1S/C24H28N6O2S/c1-24(2)10-16-17(13-32-24)22(30(3)12-15-6-5-7-25-11-15)29-23-18(16)19-20(33-23)21(28-14-27-19)26-8-9-31-4/h5-7,11,14H,8-10,12-13H2,1-4H3,(H,26,27,28) |
| InChIKey | WJQPNVSHIXSUJV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|