C27H48O4Si — CID 11662689
(1R,3aR,6aS)-1-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one (PubChem CID 11662689) has the molecular formula C27H48O4Si and a molecular weight of 464.76 g/mol. Its IUPAC name is (1R,3aR,6aS)-1-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one.
| Compound Name | (1R,3aR,6aS)-1-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one |
|---|---|
| PubChem CID | 11662689 |
| Molecular Formula | C27H48O4Si |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | (1R,3aR,6aS)-1-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1C(=O)C[C@@H]2CC3(C[C@@H]21)OCC(C)(C)CO3)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O4Si/c1-9-10-11-12-21(31-32(7,8)25(2,3)4)13-14-22-23-17-27(16-20(23)15-24(22)28)29-18-26(5,6)19-30-27/h13-14,20-23H,9-12,15-19H2,1-8H3/b14-13+/t20-,21+,22-,23+/m1/s1 |
| InChIKey | AZIQCFVXHWJRNY-LRQXVHGYSA-N |
| XLogP | 6.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|