C10H20F3NS — CID 116627209
2,2-dimethyl-7-(trifluoromethylsulfanyl)heptan-3-amine (PubChem CID 116627209) has the molecular formula C10H20F3NS and a molecular weight of 243.34 g/mol. Its IUPAC name is 2,2-dimethyl-7-(trifluoromethylsulfanyl)heptan-3-amine.
| Compound Name | 2,2-dimethyl-7-(trifluoromethylsulfanyl)heptan-3-amine |
|---|---|
| PubChem CID | 116627209 |
| Molecular Formula | C10H20F3NS |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2,2-dimethyl-7-(trifluoromethylsulfanyl)heptan-3-amine |
| SMILES | CC(C)(C)C(N)CCCCSC(F)(F)F |
| InChI | InChI=1S/C10H20F3NS/c1-9(2,3)8(14)6-4-5-7-15-10(11,12)13/h8H,4-7,14H2,1-3H3 |
| InChIKey | XIAUGISEHZQVML-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|