C25H34N5O4+ — CID 11662745
[(1R)-1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]piperidin-1-ium-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 11662745) has the molecular formula C25H34N5O4+ and a molecular weight of 468.58 g/mol. Its IUPAC name is [(1R)-1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]piperidin-1-ium-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(1R)-1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]piperidin-1-ium-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 11662745 |
| Molecular Formula | C25H34N5O4+ |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | [(1R)-1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]piperidin-1-ium-3-yl] 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N@@+]1(CC(=O)Nc2ncncn2)CCCC(OC(=O)C(O)(c2ccccc2)C2CCCCC2)C1 |
| InChI | InChI=1S/C25H33N5O4/c1-30(16-22(31)29-24-27-17-26-18-28-24)14-8-13-21(15-30)34-23(32)25(33,19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2,4-5,9-10,17-18,20-21,33H,3,6-8,11-16H2,1H3/p+1/t21?,25?,30-/m1/s1 |
| InChIKey | MEHUJEGPUFPPPL-VDOBOPNRSA-O |
| XLogP | 2.43 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|