About 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine
5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine (PubChem CID 116627530) has the molecular formula C12H21F3N2S
and a molecular weight of 282.38 g/mol. Its IUPAC name is 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine.
Molecular Properties
| Compound Name | 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine |
| PubChem CID | 116627530 |
| Molecular Formula | C12H21F3N2S |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine |
| SMILES | CC1CNC(C)(C2CC2)CN1CCSC(F)(F)F |
| InChI | InChI=1S/C12H21F3N2S/c1-9-7-16-11(2,10-3-4-10)8-17(9)5-6-18-12(13,14)15/h9-10,16H,3-8H2,1-2H3 |
| InChIKey | SLCCLBLENRVANM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine?
The IUPAC name of 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine (CID 116627530) is 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine.
What is the SMILES notation for 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine?
The canonical SMILES for 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine is CC1CNC(C)(C2CC2)CN1CCSC(F)(F)F.
What is the InChIKey of 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine?
The InChIKey is SLCCLBLENRVANM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N2S/c1-9-7-16-11(2,10-3-4-10)8-17(9)5-6-18-12(13,14)15/h9-10,16H,3-8H2,1-2H3.
What are the key properties of 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine?
5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine has a molecular weight of 282.38 g/mol, XLogP of 2.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-2,5-dimethyl-1-[2-(trifluoromethylsulfanyl)ethyl]piperazine is sourced from PubChem (CID 116627530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).