C26H36N2O2SSi — CID 11662776
(3aS,4S,6aR)-1,3-dibenzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one (PubChem CID 11662776) has the molecular formula C26H36N2O2SSi and a molecular weight of 468.74 g/mol. Its IUPAC name is (3aS,4S,6aR)-1,3-dibenzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4S,6aR)-1,3-dibenzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 11662776 |
| Molecular Formula | C26H36N2O2SSi |
| Molecular Weight | 468.74 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (3aS,4S,6aR)-1,3-dibenzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1SC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C26H36N2O2SSi/c1-26(2,3)32(4,5)30-18-23-24-22(19-31-23)27(16-20-12-8-6-9-13-20)25(29)28(24)17-21-14-10-7-11-15-21/h6-15,22-24H,16-19H2,1-5H3/t22-,23+,24-/m0/s1 |
| InChIKey | WLUYOFKQPREQAN-VXNXHJTFSA-N |
| XLogP | 6.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|