C11H20F3NS — CID 116627819
[4-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methanamine (PubChem CID 116627819) has the molecular formula C11H20F3NS and a molecular weight of 255.35 g/mol. Its IUPAC name is [4-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methanamine.
| Compound Name | [4-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 116627819 |
| Molecular Formula | C11H20F3NS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | [4-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methanamine |
| SMILES | CC1CCC(CN)(CCSC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H20F3NS/c1-9-2-4-10(8-15,5-3-9)6-7-16-11(12,13)14/h9H,2-8,15H2,1H3 |
| InChIKey | KAYKKALLWBVOTR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |