C12H22F3NS — CID 116627821
[4-ethyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methanamine (PubChem CID 116627821) has the molecular formula C12H22F3NS and a molecular weight of 269.38 g/mol. Its IUPAC name is [4-ethyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methanamine.
| Compound Name | [4-ethyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 116627821 |
| Molecular Formula | C12H22F3NS |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | [4-ethyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methanamine |
| SMILES | CCC1CCC(CN)(CCSC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3NS/c1-2-10-3-5-11(9-16,6-4-10)7-8-17-12(13,14)15/h10H,2-9,16H2,1H3 |
| InChIKey | GFANUPFHFXUKPK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |