C15H28F3NS — CID 116628199
N-[[4-propyl-2-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methyl]ethanamine (PubChem CID 116628199) has the molecular formula C15H28F3NS and a molecular weight of 311.46 g/mol. Its IUPAC name is N-[[4-propyl-2-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methyl]ethanamine.
| Compound Name | N-[[4-propyl-2-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methyl]ethanamine |
|---|---|
| PubChem CID | 116628199 |
| Molecular Formula | C15H28F3NS |
| Molecular Weight | 311.46 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | N-[[4-propyl-2-[2-(trifluoromethylsulfanyl)ethyl]cyclohexyl]methyl]ethanamine |
| SMILES | CCCC1CCC(CNCC)C(CCSC(F)(F)F)C1 |
| InChI | InChI=1S/C15H28F3NS/c1-3-5-12-6-7-14(11-19-4-2)13(10-12)8-9-20-15(16,17)18/h12-14,19H,3-11H2,1-2H3 |
| InChIKey | VXEUTCKYZULVMX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |