C7H10F3N3O2S2 — CID 116628274
2-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]imidazole-4-sulfonamide (PubChem CID 116628274) has the molecular formula C7H10F3N3O2S2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]imidazole-4-sulfonamide.
| Compound Name | 2-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 116628274 |
| Molecular Formula | C7H10F3N3O2S2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2-methyl-1-[2-(trifluoromethylsulfanyl)ethyl]imidazole-4-sulfonamide |
| SMILES | Cc1nc(S(N)(=O)=O)cn1CCSC(F)(F)F |
| InChI | InChI=1S/C7H10F3N3O2S2/c1-5-12-6(17(11,14)15)4-13(5)2-3-16-7(8,9)10/h4H,2-3H2,1H3,(H2,11,14,15) |
| InChIKey | JMQLQNWOOFWLLK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |