About dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate
dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate (PubChem CID 116628319) has the molecular formula C12H19F3O4S
and a molecular weight of 316.34 g/mol. Its IUPAC name is dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate.
Molecular Properties
| Compound Name | dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate |
| PubChem CID | 116628319 |
| Molecular Formula | C12H19F3O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate |
| SMILES | CC(C)OC(=O)C(CCSC(F)(F)F)C(=O)OC(C)C |
| InChI | InChI=1S/C12H19F3O4S/c1-7(2)18-10(16)9(11(17)19-8(3)4)5-6-20-12(13,14)15/h7-9H,5-6H2,1-4H3 |
| InChIKey | UNIXKNRYDKDMKC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate?
The IUPAC name of dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate (CID 116628319) is dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate.
What is the SMILES notation for dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate?
The canonical SMILES for dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate is CC(C)OC(=O)C(CCSC(F)(F)F)C(=O)OC(C)C.
What is the InChIKey of dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate?
The InChIKey is UNIXKNRYDKDMKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3O4S/c1-7(2)18-10(16)9(11(17)19-8(3)4)5-6-20-12(13,14)15/h7-9H,5-6H2,1-4H3.
What are the key properties of dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate?
dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate has a molecular weight of 316.34 g/mol, XLogP of 3.15, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl 2-[2-(trifluoromethylsulfanyl)ethyl]propanedioate is sourced from PubChem (CID 116628319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).