C11H13F3N2O3 — CID 116628550
3-amino-N-(2-hydroxyethyl)-N-methyl-4-(trifluoromethoxy)benzamide (PubChem CID 116628550) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 3-amino-N-(2-hydroxyethyl)-N-methyl-4-(trifluoromethoxy)benzamide.
| Compound Name | 3-amino-N-(2-hydroxyethyl)-N-methyl-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 116628550 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-amino-N-(2-hydroxyethyl)-N-methyl-4-(trifluoromethoxy)benzamide |
| SMILES | CN(CCO)C(=O)c1ccc(OC(F)(F)F)c(N)c1 |
| InChI | InChI=1S/C11H13F3N2O3/c1-16(4-5-17)10(18)7-2-3-9(8(15)6-7)19-11(12,13)14/h2-3,6,17H,4-5,15H2,1H3 |
| InChIKey | YCAOVFJDRCPEGC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|