C11H11F3N2O2S — CID 116628724
N-(1-amino-1-sulfanylidenepropan-2-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 116628724) has the molecular formula C11H11F3N2O2S and a molecular weight of 292.28 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenepropan-2-yl)-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 116628724 |
| Molecular Formula | C11H11F3N2O2S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | CC(NC(=O)c1ccc(OC(F)(F)F)cc1)C(N)=S |
| InChI | InChI=1S/C11H11F3N2O2S/c1-6(9(15)19)16-10(17)7-2-4-8(5-3-7)18-11(12,13)14/h2-6H,1H3,(H2,15,19)(H,16,17) |
| InChIKey | SNHHHCXAJYKSOU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|