C27H42N2O5 — CID 11662897
(3S,4R,5R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[[3-[(3R)-3-hydroxyoct-1-ynyl]phenyl]methyl]-N-(3-methylbutyl)-1,2-oxazolidine-3-carboxamide (PubChem CID 11662897) has the molecular formula C27H42N2O5 and a molecular weight of 474.64 g/mol. Its IUPAC name is (3S,4R,5R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[[3-[(3R)-3-hydroxyoct-1-ynyl]phenyl]methyl]-N-(3-methylbutyl)-1,2-oxazolidine-3-carboxamide.
| Compound Name | (3S,4R,5R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[[3-[(3R)-3-hydroxyoct-1-ynyl]phenyl]methyl]-N-(3-methylbutyl)-1,2-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 11662897 |
| Molecular Formula | C27H42N2O5 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | (3S,4R,5R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[[3-[(3R)-3-hydroxyoct-1-ynyl]phenyl]methyl]-N-(3-methylbutyl)-1,2-oxazolidine-3-carboxamide |
| SMILES | CCCCC[C@@H](O)C#Cc1cccc(CN2O[C@@H](CO)[C@@H]([C@H](C)O)[C@H]2C(=O)NCCC(C)C)c1 |
| InChI | InChI=1S/C27H42N2O5/c1-5-6-7-11-23(32)13-12-21-9-8-10-22(16-21)17-29-26(27(33)28-15-14-19(2)3)25(20(4)31)24(18-30)34-29/h8-10,16,19-20,23-26,30-32H,5-7,11,14-15,17-18H2,1-4H3,(H,28,33)/t20-,23+,24-,25+,26-/m0/s1 |
| InChIKey | STLMYXCIKUZIOX-KHFNFKJPSA-N |
| XLogP | 2.62 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|